CymitQuimica logo

CAS 1007878-98-9

:

α-(Dimethylamino)-2-thiopheneacetic acid

Description:
α-(Dimethylamino)-2-thiopheneacetic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a dimethylamino group. This compound typically exhibits properties associated with both amino acids and thiophene derivatives, such as potential solubility in polar solvents due to the presence of the amino group. The thiophene ring contributes to its aromatic character, which can influence its reactivity and interaction with other chemical species. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the dimethylamino group can enhance its basicity and influence its behavior in various chemical environments. Additionally, this compound may participate in various chemical reactions, including acylation and alkylation, due to the functional groups present. Overall, α-(Dimethylamino)-2-thiopheneacetic acid is a versatile compound with potential applications in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-9(2)7(8(10)11)6-4-3-5-12-6/h3-5,7H,1-2H3,(H,10,11)
InChI key:InChIKey=HVTXXPZYOOORSV-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=CC=CS1
Synonyms:
  • α-(Dimethylamino)-2-thiopheneacetic acid
  • 2-(Dimethylamino)-2-(thiophen-2-yl)acetic acid
  • 2-Thiopheneacetic acid, α-(dimethylamino)-
Found 3 products.