CymitQuimica logo

CAS 1007912-97-1

:

(4R)-4-Fluoro-1-methyl-L-proline

Description:
(4R)-4-Fluoro-1-methyl-L-proline is a fluorinated derivative of proline, an amino acid that plays a crucial role in protein synthesis and structure. This compound features a fluorine atom at the fourth carbon position, which can influence its biological activity and interactions. The presence of the methyl group at the first carbon enhances its lipophilicity, potentially affecting its permeability through biological membranes. As a chiral molecule, it exists in a specific stereoisomeric form, which is significant in pharmacology, as the stereochemistry can greatly influence the compound's efficacy and safety in biological systems. The compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential applications in modulating biological pathways. Its unique structural characteristics may also contribute to its role as a building block in the synthesis of more complex molecules. Overall, (4R)-4-Fluoro-1-methyl-L-proline exemplifies the importance of structural modifications in amino acids for enhancing biological properties.
Formula:C6H10FNO2
InChI:InChI=1S/C6H10FNO2/c1-8-3-4(7)2-5(8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)/t4-,5+/m1/s1
InChI key:InChIKey=WWTABXAXNXQPOH-UHNVWZDZSA-N
SMILES:C(O)(=O)[C@@H]1C[C@@H](F)CN1C
Synonyms:
  • (4R)-4-Fluoro-1-methyl-L-proline
  • L-Proline, 4-fluoro-1-methyl-, (4R)-
  • (4r)-4-Fluoro-1-methyl-L-proline
  • (4R)-Fluoro-1-methyl-L-proline
Found 1 products.