CAS 1008-75-9

3-METHYL-5-PHENYLISOXAZOLE

Description:

3-Methyl-5-phenylisoxazole is an organic compound characterized by its isoxazole ring structure, which consists of a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound features a methyl group at the 3-position and a phenyl group at the 5-position of the isoxazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is known for its moderate solubility in organic solvents. The presence of the phenyl group enhances its aromatic character, which can influence its reactivity and interactions with other molecules. 3-Methyl-5-phenylisoxazole has been studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its molecular structure allows for various functionalization possibilities, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₀H₉NO

InChI: InChI=1/C10H9NO/c1-8-7-10(12-11-8)9-5-3-2-4-6-9/h2-7H,1H3

SMILES: Cc1cc(c2ccccc2)on1

Synonyms:

• Isoxazole, 3-methyl-5-phenyl- (6CI,7CI,8CI,9CI)
• 3-Methyl-5-phenylisoxazole ,97%
• 3-Methyl-5-Phenyl-1,2-Oxazole

3-Methyl-5-Phenylisoxazole

CAS: 1008-75-9

3-Methyl-5-Phenylisoxazole

Formula: C₁₀H₉NO

Purity: 98%

Molecular weight: 159.18

Ref: 54-OR1011041

Isoxazole, 3-methyl-5-phenyl-

CAS: 1008-75-9

Formula: C₁₀H₉NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.1846

Ref: IN-DA0002XC

3-Methyl-5-phenylisoxazole

CAS: 1008-75-9

Formula: C₁₀H₉NO

Purity: 98%

Molecular weight: 159.188

Ref: 10-F340201

3-Methyl-5-phenylisoxazole

Controlled Product

CAS: 1008-75-9

Applications 3-methyl-5-phenylisoxazole (cas# 1008-75-9) is a useful research chemical.

Formula: C₁₀H₉NO

Color and Shape: Neat

Molecular weight: 159.18

Ref: TR-M218910