CAS 1008-79-3
:1,2-Dihydro-1-phenyl-3H-pyrazol-3-one
Description:
1,2-Dihydro-1-phenyl-3H-pyrazol-3-one, with the CAS number 1008-79-3, is an organic compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many pyrazolone derivatives. The presence of the phenyl group contributes to its stability and reactivity, allowing for various chemical modifications. Additionally, 1,2-dihydro-1-phenyl-3H-pyrazol-3-one can participate in various chemical reactions, including condensation and substitution reactions, making it a versatile intermediate in organic synthesis. Its derivatives may exhibit anti-inflammatory, analgesic, or antipyretic properties, reflecting the broader pharmacological interest in pyrazolone compounds. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c12-9-6-7-11(10-9)8-4-2-1-3-5-8/h1-7H,(H,10,12)
InChI key:InChIKey=MKMDCEXRIPLNGJ-UHFFFAOYSA-N
SMILES:O=C1NN(C=C1)C2=CC=CC=C2
Synonyms:- 3H-Pyrazol-3-one, 1,2-dihydro-1-phenyl-
- 1-Phenyl-3-hydroxypyrazole
- 1,2-Dihydro-1-phenyl-3H-pyrazol-3-one
- 3-Pyrazolin-5-one, 2-phenyl-
- Pyrazol-3-ol, 1-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenyl-1H-pyrazol-3(2H)-one
CAS:1-Phenyl-1H-pyrazol-3(2H)-oneFormula:C9H8N2OPurity:98%Molecular weight:160.1763H-Pyrazol-3-one, 1,2-dihydro-1-phenyl-
CAS:Formula:C9H8N2OPurity:97%Color and Shape:SolidMolecular weight:160.17261-Phenyl-1H-pyrazol-3(2H)-one
CAS:1-Phenyl-1H-pyrazol-3(2H)-one is a molecule that has been synthesized in the form of a cyclic compound. It can be used for the synthesis of polymers, which are used as coatings and adhesives. The molecule's structure was determined by x-ray crystallography. The chemical properties of 1-phenyl-1H-pyrazol-3(2H)-one depend on its oxidation state, which can be reversibly oxidized to the corresponding quinone with a cyclic voltammetry strategy. This process involves the use of a solid electrode and nonpolar solvents, such as chloroform or ether. This reaction is irreversible and leads to oxidation of 1-phenyl-1H-pyrazol-3(2H)-one to the quinone form. The molecule has also been synthesized using a solid phase synthesis technique involving methoxy groups as monomersFormula:C9H8N2OPurity:Min. 95%Molecular weight:160.17 g/mol



