CymitQuimica logo

CAS 100800-40-6

:

Benzenamine, 4-[3-(4-morpholinyl)propoxy]-

Description:
Benzenamine, 4-[3-(4-morpholinyl)propoxy]- is an organic compound characterized by its amine and ether functional groups. It features a benzene ring substituted at the para position with a propoxy group that is further substituted with a morpholine ring. This structure imparts both hydrophilic and lipophilic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The morpholine moiety contributes to its basicity and can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit biological activity, which could be explored for therapeutic purposes. Its molecular structure suggests that it may interact with biological systems, potentially influencing receptor binding or enzyme activity. Safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity. Overall, the unique combination of functional groups in Benzenamine, 4-[3-(4-morpholinyl)propoxy]- suggests a versatile compound with applications in medicinal chemistry and materials science.
Formula:C13H20N2O2
InChI:InChI=1S/C13H20N2O2/c14-12-2-4-13(5-3-12)17-9-1-6-15-7-10-16-11-8-15/h2-5H,1,6-11,14H2
InChI key:KDHPQNXUMCNVCX-UHFFFAOYSA-N
SMILES:C1COCCN1CCCOC2=CC=C(C=C2)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.