CAS 1008106-93-1

Formula: C6H5BBr2O2

InChI: InChI=1S/C6H5BBr2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H

InChI key: CMLBXUUGERIZOO-UHFFFAOYSA-N

SMILES: B(C1=C(C=CC(=C1)Br)Br)(O)O

Boronic acid, B-(2,5-dibromophenyl)-

CAS: 1008106-93-1

Formula: C₆H₅BBr₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.7217

Ref: IN-DA0002XT

2,5-Dibromophenylboronic acid

CAS: 1008106-93-1

2,5-Dibromophenylboronic acid

Formula: C₆H₅BBr₂O₂

Purity: >97%

Molecular weight: 279.7217

Ref: 54-OR350147

2,5-Dibromophenylboronic acid

CAS: 1008106-93-1

Formula: C₆H₅BBr₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.72

Ref: 10-F225446

2,5-Dibromophenylboronic acid

CAS: 1008106-93-1

2,5-Dibromophenylboronic acid

Formula: C₆H₅BBr₂O₂

Purity: 98%

Molecular weight: 279.72

Ref: IN-DG01391073