CymitQuimica logo

CAS 1008136-15-9

:

3-(3-Methyl-3H-diazirin-3-yl)propan-1-amine

Description:
3-(3-Methyl-3H-diazirin-3-yl)propan-1-amine, identified by its CAS number 1008136-15-9, is a chemical compound characterized by the presence of a diazirine functional group, which is known for its ability to undergo photochemical reactions upon exposure to ultraviolet light. This compound features a propan-1-amine backbone, indicating the presence of an amine functional group that can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The diazirine moiety is particularly notable for its use in bioconjugation and labeling studies, as it can form covalent bonds with nearby molecules upon activation. The presence of the methyl group on the diazirine enhances its stability and reactivity. Overall, this compound is of interest in fields such as medicinal chemistry and biochemistry, where it may be utilized for targeted drug delivery or as a tool for studying protein interactions. Its unique structural features and reactivity make it a valuable compound for research applications.
Formula:C5H11N3
InChI:InChI=1S/C5H11N3/c1-5(7-8-5)3-2-4-6/h2-4,6H2,1H3
InChI key:NMWJNUYCZYGPMO-UHFFFAOYSA-N
SMILES:CC1(N=N1)CCCN
Synonyms:
  • 3H-Diazirine-3-propanamine, 3-methyl-
  • 3-(3-Methyl-3H-diazirin-3-yl)propan-1-amine
Found 3 products.