CymitQuimica logo

CAS 100833-45-2

:

4-[4-(octyloxy)phenyl]-4-oxobutanoic acid

Description:
4-[4-(Octyloxy)phenyl]-4-oxobutanoic acid, identified by its CAS number 100833-45-2, is an organic compound characterized by its unique molecular structure that includes a phenyl group substituted with an octyloxy chain and a butanoic acid moiety. This compound typically exhibits amphiphilic properties due to the presence of both hydrophobic (octyloxy) and hydrophilic (carboxylic acid) functional groups, which can influence its solubility in various solvents. It may display liquid crystalline behavior, making it of interest in materials science, particularly in the development of liquid crystal displays (LCDs) and other advanced materials. The presence of the carbonyl group contributes to its reactivity, allowing for potential applications in organic synthesis and polymer chemistry. Additionally, the octyloxy group enhances its hydrophobic characteristics, which can affect its interactions in biological systems or in formulations. Overall, this compound's structural features suggest versatility in applications ranging from industrial to pharmaceutical fields.
Formula:C18H26O4
InChI:InChI=1/C18H26O4/c1-2-3-4-5-6-7-14-22-16-10-8-15(9-11-16)17(19)12-13-18(20)21/h8-11H,2-7,12-14H2,1H3,(H,20,21)
InChI key:SLXMWMVPAKQKJT-UHFFFAOYSA-N
SMILES:CCCCCCCCOc1ccc(cc1)C(=O)CCC(=O)O
Found 2 products.