CAS 100836-88-2
:Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)- b-D-glucopyranoside
Description:
Methyl 2-Acetamido-2-deoxy-3-O-(β-D-galactopyranosyl)-β-D-glucopyranoside, with the CAS number 100836-88-2, is a glycosylated compound that features a methyl group, an acetamido group, and two sugar moieties: β-D-glucopyranoside and β-D-galactopyranoside. This compound is characterized by its structural complexity, which includes multiple hydroxyl groups that contribute to its solubility in polar solvents, such as water. It exhibits properties typical of carbohydrates, including potential biological activity, as it may interact with various biological systems, including enzymes and receptors. The presence of the acetamido group suggests that it may have applications in medicinal chemistry, particularly in the design of glycosylated drugs or as a potential substrate for glycosyltransferases. Additionally, the methyl esterification of the hydroxyl group enhances its stability and lipophilicity, which can influence its pharmacokinetic properties. Overall, this compound is of interest in both synthetic and biological chemistry due to its structural features and potential applications.
Formula:C15H27NO11
InChI:InChI=1/C15H27NO11/c1-5(19)16-8-13(10(21)7(4-18)25-14(8)24-2)27-15-12(23)11(22)9(20)6(3-17)26-15/h6-15,17-18,20-23H,3-4H2,1-2H3,(H,16,19)
SMILES:CC(=NC1C(C(C(CO)OC1OC)O)OC1C(C(C(C(CO)O1)O)O)O)O
Synonyms:- Methyl2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranose
- Gal1-β-3GlcNAc1-β-OMe
- Methyl 2-Acetamido-2-deoxy-3-O-(-D-galactopyranosyl)--D-glucopyranoside
- methyl 2-(acetylamino)-2-deoxy-3-O-hexopyranosylhexopyranoside
- Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)- β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-Acetamido-2-deoxy-3-O-(ß-D-galactopyranosyl)-b-D-glucopyranoside
CAS:Formula:C15H27NO11Color and Shape:SolidMolecular weight:397.375Methyl 2-Acetamido-2-deoxy-3-O-(ß-D-galactopyranosyl)-β-D-glucopyranoside
CAS:Controlled ProductApplications Methyl 2-Acetamido-2-deoxy-3-O-(ß-D-galactopyranosyl)-β-D-glucopyranoside (cas# 100836-88-2) is a compound useful in organic synthesis.
Formula:C15H27NO11Color and Shape:NeatMolecular weight:397.38Methyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
CAS:Methyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is a modification of the carbohydrate, which is a complex carbohydrate. It has been synthesized using Custom synthesis and Oligosaccharide. This product is highly pure, with a purity of 99%. Methyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-Dpglucopyranoside is used in the synthesis of Monosaccharide and Methylation. It can also be used in Glycosylation and Polysaccharide as well as for sugar or Fluorination.Formula:C15H27NO11Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:397.38 g/mol



