CymitQuimica logo

CAS 1008361-66-7

:

7-Bromo-6-methoxy-1H-benzimidazole

Description:
7-Bromo-6-methoxy-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a bromine atom at the 7-position and a methoxy group at the 6-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmacological applications. The bromine substituent can enhance the compound's reactivity and influence its solubility and stability, while the methoxy group may affect its electronic properties and interactions with biological targets. In terms of physical properties, compounds of this class often display moderate to high melting points and solubility in organic solvents. The presence of halogens and methoxy groups can also contribute to the compound's lipophilicity, impacting its bioavailability and distribution in biological systems. Overall, 7-Bromo-6-methoxy-1H-benzimidazole is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-12-6-3-2-5-8(7(6)9)11-4-10-5/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=JVAWQPUYDFNYKV-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1OC)N=CN2
Synonyms:
  • 4-Bromo-5-(methyloxy)-1H-benzimidazole
  • 7-Bromo-6-methoxy-1H-benzimidazole
  • 1H-Benzimidazole, 7-bromo-6-methoxy-
  • 4-Bromo-5-methoxy-1H-benzo[d]imidazole
Found 1 products.