CymitQuimica logo

CAS 1008451-58-8

:

4-Chloro-2-methoxynicotinaldehyde

Description:
4-Chloro-2-methoxynicotinaldehyde is an organic compound that belongs to the class of nicotinic aldehydes. It features a pyridine ring, which is characteristic of nicotinic compounds, and contains both a chloro and a methoxy substituent, contributing to its unique chemical properties. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. This compound is typically a pale yellow to brown solid and is soluble in organic solvents, reflecting its moderate polarity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with nicotinic derivatives. Additionally, the chloro and methoxy groups can influence the compound's reactivity and interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-2-methoxynicotinaldehyde is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c1-11-7-5(4-10)6(8)2-3-9-7/h2-4H,1H3
InChI key:FURZPPOFSODEOQ-UHFFFAOYSA-N
SMILES:COC1=NC=CC(=C1C=O)Cl
Found 6 products.