CAS 100846-24-0
:5-(Trifluoromethyl)indole
Description:
5-(Trifluoromethyl)indole is an organic compound characterized by the presence of an indole ring substituted with a trifluoromethyl group at the 5-position. The indole structure consists of a fused benzene and pyrrole ring, contributing to its aromatic properties and potential biological activity. The trifluoromethyl group, which is a highly electronegative substituent, significantly influences the compound's chemical reactivity and lipophilicity, often enhancing its pharmacological properties. This compound is typically a solid at room temperature and is known for its stability under various conditions, although it may undergo reactions typical of indole derivatives, such as electrophilic substitution. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms can improve metabolic stability and bioavailability, making it a valuable scaffold in drug design. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C8H7BrFNO
InChI:InChI=1/C8H7BrFNO/c1-5(12)11-8-3-2-6(10)4-7(8)9/h2-4H,1H3,(H,11,12)
SMILES:CC(=Nc1ccc(cc1Br)F)O
Synonyms:- 1H-Indole, 5-(Triflu Oromethyl)- (9Ci)
- 5-Trifluoromethyl Indole ,98%
- N-(2-bromo-4-fluorophenyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-(Trifluoromethyl)indole, 98%
CAS:In 3-Naphthylindole construction by rhodium (II)-catalyzed regioselective direct arylation of indoles with 1-diazonaphthalen-2-(1H)-ones treatment of 5-(trifluoromethyl)indole(1k) or 6-(trifluoromethyl)indole (1l) with 2a afforded the desired products 3k (86%)and 3l (86%).This Thermo Scientific ChemFormula:C9H6F3NPurity:98%Color and Shape:Pale yellow to brown, PowderMolecular weight:185.155-(Trifluoromethyl)-1H-indole
CAS:5-(Trifluoromethyl)-1H-indoleFormula:C9H6F3NPurity:98%Color and Shape:Solid-PowderMolecular weight:185.145841H-Indole, 5-(trifluoromethyl)-
CAS:Formula:C9H6F3NPurity:98%Color and Shape:SolidMolecular weight:185.1458Ref: IN-DA0002ZS
100gTo inquire50mg28.00€100mg28.00€250mg32.00€1g55.00€5g134.00€10g158.00€25g327.00€50g549.00€5-(Trifluoromethyl)indole
CAS:5-(Trifluoromethyl)indole is an indole derivative that binds to both orthosteric and allosteric sites of the 5-HT receptor, which is a G protein-coupled receptor. The affinity of 5-(Trifluoromethyl)indole for the 5-HT receptor is approximately 10 times greater than for other receptors, making it a potent ligand. This compound has been shown to inhibit colitis in mice by binding to the 5-HT3 receptor and inhibiting calcium ion influx. It also inhibits deuterolysis and catalysis in cells at high concentrations. Research on this drug has shown that it can be used as an endogenous ligand for the 5-HT3 receptor, but its activity is not as potent as when it is used as a ligand.Formula:C9H6F3NPurity:Min. 95%Color and Shape:PowderMolecular weight:185.15 g/mol






