CymitQuimica logo

CAS 100859-84-5

:

2-Chloro isonicotinamide

Description:
2-Chloro isonicotinamide is a chemical compound that belongs to the class of isonicotinamides, which are derivatives of nicotinamide. It features a chlorine atom substituted at the second position of the isonicotinamide structure, which is a pyridine derivative. This compound is characterized by its molecular formula, which includes carbon, hydrogen, nitrogen, and chlorine atoms. It typically appears as a solid or crystalline substance and is soluble in polar solvents. 2-Chloro isonicotinamide has garnered interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Its structure allows for interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions are essential when working with this compound, as with many chemicals, due to potential toxicity and environmental impact. Overall, 2-Chloro isonicotinamide represents a significant compound for exploration in both synthetic and pharmaceutical chemistry.
Formula:C6H5ClN2O
InChI:InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10)
InChI key:DEMJOLRJLACBRX-UHFFFAOYSA-N
SMILES:c1cnc(cc1C(=N)O)Cl
Synonyms:
  • 6-methyl-5-nitropyridin-2(1H)-one
  • 2-Chloropyridine-4-Carboxamide
Found 5 products.