CAS 100860-96-6
:1-PROPANONE, 3-DIMETHYLAMINO-1-(3-THIENYL)-
Description:
1-Propanone, 3-dimethylamino-1-(3-thienyl)-, also known by its CAS number 100860-96-6, is an organic compound characterized by its ketone functional group and the presence of a thienyl ring, which contributes to its aromatic properties. This compound features a propanone backbone with a dimethylamino group, enhancing its potential as a nucleophile in various chemical reactions. The thienyl moiety, derived from thiophene, introduces sulfur into the structure, which can influence the compound's electronic properties and reactivity. Typically, compounds of this nature may exhibit moderate to high polarity due to the presence of the polar carbonyl group, and they may participate in hydrogen bonding. The presence of the dimethylamino group can also impart basicity, making the compound potentially useful in various applications, including pharmaceuticals and agrochemicals. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C9H13NOS
InChI:InChI=1S/C9H13NOS/c1-10(2)5-3-9(11)8-4-6-12-7-8/h4,6-7H,3,5H2,1-2H3
InChI key:DYYOWHYLIHNOQQ-UHFFFAOYSA-N
SMILES:CN(C)CCC(=O)C1=CSC=C1
Synonyms:- 1-Propanone, 3-Dimethylamino-1-(3-Thienyl)-(6Ci)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

