CymitQuimica logo

CAS 100866-13-5

:

2-PYRIDIN-4-YL-1-P-TOLYL-ETHANONE

Description:
2-Pyridin-4-yl-1-p-tolyl-ethanone, with the CAS number 100866-13-5, is an organic compound characterized by its complex structure, which includes a pyridine ring and a ketone functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic components. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The presence of both pyridine and aromatic groups contributes to its potential biological activity, making it a subject of interest in various research fields. Additionally, its chemical properties, such as reactivity and stability, can be influenced by the substituents on the aromatic rings, which may affect its interaction with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H13NO
InChI:InChI=1S/C14H13NO/c1-11-2-4-13(5-3-11)14(16)10-12-6-8-15-9-7-12/h2-9H,10H2,1H3
InChI key:XUCKHEMSKSGZAI-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C(=O)CC2=CC=NC=C2
Synonyms:
  • 2-Pyridin-4-yl-1-p-polyl-ethanone
Found 3 products.