CymitQuimica logo

CAS 100868-76-6

:

Methanesulfonamide, N-methyl-N-2-pyridinyl-

Description:
Methanesulfonamide, N-methyl-N-2-pyridinyl- is an organic compound characterized by the presence of a methanesulfonamide group attached to a N-methyl-2-pyridinyl moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The N-methyl substitution enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The pyridine ring contributes to the compound's aromaticity and can participate in coordination with metal ions or engage in π-π interactions. Methanesulfonamide derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's molecular structure suggests it may exhibit polar characteristics due to the sulfonamide group, while the pyridine ring may provide additional reactivity and stability. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.
Formula:C7H10N2O2S
InChI:InChI=1S/C7H10N2O2S/c1-9(12(2,10)11)7-5-3-4-6-8-7/h3-6H,1-2H3
InChI key:DMPWOUKEHUZQAR-UHFFFAOYSA-N
SMILES:CN(C1=CC=CC=N1)S(=O)(=O)C
Found 1 products.