CAS 100875-69-2
:Benzaldehyde, 4-[2-(4-methyl-1-piperazinyl)ethoxy]-
Description:
Benzaldehyde, 4-[2-(4-methyl-1-piperazinyl)ethoxy]- is an organic compound characterized by its structure, which includes a benzaldehyde moiety and a piperazine derivative. This compound typically exhibits a colorless to pale yellow liquid form with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic characteristics. The presence of the piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may also exhibit properties such as moderate volatility and reactivity, particularly in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the aldehyde group. Safety data indicates that it should be handled with care, as it may cause irritation to the skin, eyes, and respiratory system. Overall, this compound's unique structure and properties make it a valuable subject for research in various chemical and pharmaceutical applications.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-15-6-8-16(9-7-15)10-11-18-14-4-2-13(12-17)3-5-14/h2-5,12H,6-11H2,1H3
InChI key:AGAKHJJMBZUXKF-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)CCOC2=CC=C(C=C2)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
