CAS 100884-80-8
:1,3,5,7-Adamantanetetracarboxylic acid
Description:
1,3,5,7-Adamantanetetracarboxylic acid is a polycarboxylic acid characterized by its unique adamantane structure, which consists of a diamond-like cage framework. This compound features four carboxylic acid functional groups (-COOH) attached to the adamantane core at the 1, 3, 5, and 7 positions, contributing to its high polarity and potential for strong intermolecular interactions. The presence of multiple carboxylic acid groups enhances its solubility in polar solvents and allows for the formation of hydrogen bonds, which can influence its reactivity and stability. This compound is of interest in various fields, including materials science and organic synthesis, due to its potential applications in the development of functional materials and as a building block in organic chemistry. Additionally, its unique structure may impart interesting properties such as thermal stability and the ability to form complexes with metal ions. Overall, 1,3,5,7-Adamantanetetracarboxylic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C14H16O8
InChI:InChI=1S/C14H16O8/c15-7(16)11-1-12(8(17)18)4-13(2-11,9(19)20)6-14(3-11,5-12)10(21)22/h1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)
InChI key:InChIKey=VWAIZPYLEYEEFK-UHFFFAOYSA-N
SMILES:C(O)(=O)C12CC3(C(O)=O)CC(C(O)=O)(C1)CC(C(O)=O)(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decane-1,3,5,7-tetracarboxylic acid
- 1,3,5,7-Adamantanetetracarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Adamantane-1,3,5,7-tetracarboxylic acid
CAS:Adamantane-1,3,5,7-tetracarboxylic acidFormula:C14H16O8Purity:95%Molecular weight:312.27Adamantane-1,3,5,7-tetracarboxylic acid
CAS:Adamantane-1,3,5,7-tetracarboxylic acidFormula:C14H16O8Purity:95%Molecular weight:312.27Tricyclo[3.3.1.13,7]decane-1,3,5,7-tetracarboxylic acid
CAS:Formula:C14H16O8Purity:95%Color and Shape:SolidMolecular weight:312.2720Adamantane-1,3,5,7-tetracarboxylic acid
CAS:Adamantane-1,3,5,7-tetracarboxylic acid (ADTA) is a heterocyclic compound with the chemical formula C12H22O8. It has been shown to interact with integrin receptors and form supramolecular structures in the presence of formamide. ADTA can be synthesized by condensation of butyric acid and formaldehyde in the presence of sodium hydroxide. The resulting product is a white solid that crystallizes in tetragonal space group P4/nma. The luminescence properties of ADTA have been studied using x-ray diffraction and pairwise interactions with anions.Formula:C14H16O8Purity:Min. 95%Molecular weight:312.27 g/mol




