CymitQuimica logo

CAS 100884-80-8

:

1,3,5,7-Adamantanetetracarboxylic acid

Description:
1,3,5,7-Adamantanetetracarboxylic acid is a polycarboxylic acid characterized by its unique adamantane structure, which consists of a diamond-like cage framework. This compound features four carboxylic acid functional groups (-COOH) attached to the adamantane core at the 1, 3, 5, and 7 positions, contributing to its high polarity and potential for strong intermolecular interactions. The presence of multiple carboxylic acid groups enhances its solubility in polar solvents and allows for the formation of hydrogen bonds, which can influence its reactivity and stability. This compound is of interest in various fields, including materials science and organic synthesis, due to its potential applications in the development of functional materials and as a building block in organic chemistry. Additionally, its unique structure may impart interesting properties such as thermal stability and the ability to form complexes with metal ions. Overall, 1,3,5,7-Adamantanetetracarboxylic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C14H16O8
InChI:InChI=1S/C14H16O8/c15-7(16)11-1-12(8(17)18)4-13(2-11,9(19)20)6-14(3-11,5-12)10(21)22/h1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)
InChI key:InChIKey=VWAIZPYLEYEEFK-UHFFFAOYSA-N
SMILES:C(O)(=O)C12CC3(C(O)=O)CC(C(O)=O)(C1)CC(C(O)=O)(C2)C3
Synonyms:
  • Tricyclo[3.3.1.13,7]decane-1,3,5,7-tetracarboxylic acid
  • 1,3,5,7-Adamantanetetracarboxylic acid
Found 6 products.