CAS 1008946-66-4
:Ethyl 1-(2-chloroacetyl)-2-piperidinecarboxylate
Description:
Ethyl 1-(2-chloroacetyl)-2-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl ester functional group and a chloroacetyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloroacetyl group suggests that it may participate in nucleophilic substitution reactions, making it useful in the synthesis of various derivatives. The compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. Its molecular structure indicates potential biological activity, which could be explored in medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks such as irritation or toxicity. Overall, Ethyl 1-(2-chloroacetyl)-2-piperidinecarboxylate is of interest in both academic research and industrial applications, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C10H16ClNO3
InChI:InChI=1S/C10H16ClNO3/c1-2-15-10(14)8-5-3-4-6-12(8)9(13)7-11/h8H,2-7H2,1H3
InChI key:InChIKey=LVJSWQWZFDHDMV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1N(C(CCl)=O)CCCC1
Synonyms:- 2-Piperidinecarboxylic acid, 1-(2-chloroacetyl)-, ethyl ester
- Ethyl 1-(2-chloroacetyl)-2-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
