CAS 100898-62-2

5'-O-(4,4'-DIMETHOXYTRITYL)-N4-ISOBUTYRYL-2'-DEOXYCYTIDINE

Description:

5'-O-(4,4'-Dimethoxytrityl)-N4-isobutyryl-2'-deoxycytidine is a modified nucleoside that plays a significant role in the field of molecular biology and biochemistry, particularly in the synthesis of oligonucleotides. This compound features a deoxycytidine base, which is a building block of DNA, modified with an isobutyryl group at the N4 position and a dimethoxytrityl (DMT) protecting group at the 5' hydroxyl. The DMT group is commonly used to protect the 5' end during oligonucleotide synthesis, allowing for selective reactions at other sites. The presence of the isobutyryl group enhances the stability and solubility of the nucleoside, making it suitable for various biochemical applications. This compound is typically used in the synthesis of phosphoramidite derivatives for automated DNA synthesis. Its unique structural features contribute to its utility in research and therapeutic applications, including gene therapy and the development of nucleic acid-based drugs. As with many chemical substances, proper handling and storage conditions are essential to maintain its integrity and functionality.

Formula: C₃₄H₃₇N₃O₇

InChI: InChI=1S/C34H37N3O7/c1-4-8-31(39)35-30-19-20-37(33(40)36-30)32-21-28(38)29(44-32)22-43-34(23-9-6-5-7-10-23,24-11-15-26(41-2)16-12-24)25-13-17-27(42-3)18-14-25/h5-7,9-20,28-29,32,38H,4,8,21-22H2,1-3H3,(H,35,36,39,40)/t28-,29+,32+/m0/s1

InChI key: JAHWXECJHMFQQG-NPLMNSEMSA-N

SMILES: CCCC(=O)NC1=NC(=O)N(C=C1)[C@H]2C[C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O

Synonyms:

• Dmt-Nibu-Dc
• N4-(Isobutyryl)-5'-O-(Dimethoxytrityl)-2'-Deoxycytidine

5'-O-DMT-ibu-dC

CAS: 100898-62-2

5'-O-DMT-ibu-dC can be used in the synthesis of oligodeoxyribonucleotides.

Formula: C₃₄H₃₇N₃O₇

Color and Shape: Solid

Molecular weight: 599.67

Ref: TM-T38405

N-(1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyrimidin-4-yl)isobutyramide

CAS: 100898-62-2

Formula: C₃₄H₃₇N₃O₇

Purity: 95+%

Molecular weight: 599.67

Ref: IN-DG215384

2'-Deoxy-5'-O-DMT-N4-isobutyrylcytidine

CAS: 100898-62-2

2'-Deoxy-5'-O-DMT-N4-isobutyrylcytidine is a monophosphate nucleoside analog that has antiviral activity against the Herpes virus. It is a cytosine analog that is incorporated into DNA and inhibits viral replication. 2'-Deoxy-5'-O-DMT-N4-isobutyrylcytidine has also been shown to have anticancer properties and high purity. This compound is synthesized by the reaction of 2'-deoxycytidine and 4-(2,2,2,-trimethylpropionyl)-1,3-butanediol with O-(7-azabenzotriazol-1-yl) N,N,N',N' tetramethyluronium hexafluorophosphate (HATU) in anhydrous pyridine. The CAS number for this compound is 10089862.

Formula: C₃₄H₃₇N₃O₇

Purity: Min. 95%

Molecular weight: 599.69 g/mol

Ref: 3D-ND02997

5'-O-DMT-ibu-dC

CAS: 100898-62-2

Formula: C₃₄H₃₇N₃O₇

Molecular weight: 599.6735

Ref: IN-DA00033S