CymitQuimica logo

CAS 1009-01-4

:

Methanesulfonic acid, 2-methylphenyl ester

Description:
Methanesulfonic acid, 2-methylphenyl ester, also known as 2-methylphenyl methanesulfonate, is an organic compound characterized by its ester functional group derived from methanesulfonic acid and 2-methylphenol. It typically appears as a colorless to pale yellow liquid with a distinctive odor. This compound is soluble in polar organic solvents and exhibits moderate stability under standard conditions. It is known for its reactivity, particularly in nucleophilic substitution reactions, making it useful in organic synthesis and as a reagent in various chemical processes. The presence of the methanesulfonate group imparts certain properties, such as increased polarity and the ability to act as a leaving group in reactions. Additionally, it may have applications in pharmaceuticals, agrochemicals, and as an intermediate in the synthesis of other chemical compounds. Safety precautions should be observed when handling this substance, as it may cause irritation to the skin and eyes, and proper storage conditions should be maintained to ensure stability.
Formula:C8H10O3S
InChI:InChI=1S/C8H10O3S/c1-7-5-3-4-6-8(7)11-12(2,9)10/h3-6H,1-2H3
InChI key:GLMWFEJQRJWNKI-UHFFFAOYSA-N
SMILES:CC1=CC=CC=C1OS(=O)(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.