CAS 1009-22-9
:N-(2-Bromo-4-fluorophenyl)acetamide
Description:
N-(2-Bromo-4-fluorophenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and a substituted aromatic ring. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its unique chemical properties, including increased reactivity and potential for specific interactions in biological systems. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests that it may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. The bromine and fluorine substituents can influence the compound's lipophilicity and electronic properties, which are critical for its behavior in biological environments. Additionally, N-(2-Bromo-4-fluorophenyl)acetamide may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H7BrFNO
InChI:InChI=1S/C8H7BrFNO/c1-5(12)11-8-3-2-6(10)4-7(8)9/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=JAVSBNOXENOHEI-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(Br)C=C(F)C=C1
Synonyms:- 2-Bromo-4-fluoro-acetanilide
- 2?Bromo-4?Fluorophenyl Acetamide
- Acetamide, N-(2-bromo-4-fluorophenyl)-
- Acetanilide, 2′-bromo-4′-fluoro-
- N-(2-Bromo-4-fluorophenyl)acetamide
- N-2-Bromo-4-fluorophenylacetamide
- 2′-Bromo-4′-fluoroacetanilide
- 2'-Bromo-4'-fluoroacetanilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2'-Bromo-4'-fluoroacetanilide
CAS:Formula:C8H7BrFNOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:232.05N-Acetyl 2-bromo-4-fluoroaniline
CAS:Formula:C8H7BrFNOPurity:98%Color and Shape:SolidMolecular weight:232.04972'-Bromo-4'-fluoroacetanilide
CAS:2'-Bromo-4'-fluoroacetanilideFormula:C8H7BrFNOPurity:98%Molecular weight:232.049682'-Bromo-4'-fluoroacetanilide
CAS:2'-Bromo-4'-fluoroacetanilide is a synthetic derivative of acetanilide that is used in the treatment of diabetes mellitus. It has been shown to have antidiabetic properties as well as to inhibit the formation of nitrosamines, which are carcinogenic compounds. The synthesis of 2'-bromo-4'-fluoroacetanilide involves the addition of bromine and sodium hydrogen to acetylated acetanilide. This reaction occurs in a reaction vessel at an elevated temperature, with the solvent being an organic solvent. The final product is isolated by distillation and purified by recrystallization or column chromatography. Molecular docking analysis has shown that 2'-bromo-4'-fluoroacetanilide binds to ATP synthase, which is involved in gluconeogenesis and glycolysis, leading to its ability to inhibit glucose production in cells.Formula:C8H7BrFNOPurity:Min. 95%Molecular weight:232.05 g/mol




