CymitQuimica logo

CAS 1009-35-4

:

4-Fluoro-3-nitrobenzonitrile

Description:
4-Fluoro-3-nitrobenzonitrile is an aromatic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzene ring, along with a nitrile functional group. Its molecular structure consists of a benzene ring substituted at the 4-position with a fluorine atom and at the 3-position with a nitro group, while the nitrile group (-C≡N) is attached to the benzene ring. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the electronegative fluorine and nitro groups contributes to its reactivity and polarity, influencing its solubility in various organic solvents. Additionally, 4-Fluoro-3-nitrobenzonitrile may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis in laboratory settings. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C10H13FN2
InChI:InChI=1/C10H13FN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2
InChI key:LKOWKPGBAZVHOF-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)F)N1CCNCC1
Synonyms:
  • 3-Nitro-4-fluorobenzonitrile
  • 1-(2-Fluorophenyl)Piperazine
Found 9 products.