CymitQuimica logo

CAS 1009033-87-7

:

Pyridine, 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-

Description:
The chemical substance known as "Pyridine, 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-" with CAS number 1009033-87-7 is a pyridine derivative featuring a boron-containing functional group. Pyridine itself is a six-membered aromatic heterocycle with a nitrogen atom, which imparts basicity and nucleophilicity to the molecule. The presence of the tetramethyl-1,3,2-dioxaborolane moiety suggests that this compound may exhibit unique reactivity, particularly in cross-coupling reactions or as a potential ligand in organometallic chemistry. The compound is likely to be soluble in organic solvents due to its aromatic character and may participate in various chemical reactions, including electrophilic substitutions or nucleophilic attacks. Its structural features may also influence its physical properties, such as boiling point, melting point, and stability under different conditions. Overall, this compound represents a specialized class of organic molecules with potential applications in materials science and medicinal chemistry.
Formula:C17H20BNO2
InChI:InChI=1S/C17H20BNO2/c1-16(2)17(3,4)21-18(20-16)15-7-5-13(6-8-15)14-9-11-19-12-10-14/h5-12H,1-4H3
InChI key:PTNMCYWJKRZCDE-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=NC=C3
Synonyms:
  • 4-(4-Pyridinyl)Phenylboronic Acid Pinacol Ester
Found 5 products.