CAS 1009036-29-6
:7-fluoroquinazolin-4-amine
Description:
7-Fluoroquinazolin-4-amine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a fluorine atom at the 7-position and an amino group at the 4-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The fluorine substitution can enhance lipophilicity and metabolic stability, making it a candidate for drug design. Additionally, the compound may exhibit specific reactivity patterns typical of amines and halogenated compounds, which can be exploited in further synthetic applications. Overall, 7-fluoroquinazolin-4-amine represents a versatile scaffold in organic synthesis and drug discovery.
Formula:C8H6FN3
InChI:InChI=1S/C8H6FN3/c9-5-1-2-6-7(3-5)11-4-12-8(6)10/h1-4H,(H2,10,11,12)
InChI key:OYFIRSZBPDFONT-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1F)N=CN=C2N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
