CymitQuimica logo

CAS 1009101-68-1

:

Carbamic acid, N-(1H-1,2,3-triazol-5-ylmethyl)-, 1,1-dimethylethyl ester

Description:
Carbamic acid, N-(1H-1,2,3-triazol-5-ylmethyl)-, 1,1-dimethylethyl ester, identified by CAS number 1009101-68-1, is a chemical compound characterized by its unique structure that includes a carbamic acid moiety and a triazole ring. This compound typically exhibits properties associated with both carbamates and triazoles, such as potential biological activity and stability under various conditions. The presence of the triazole ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The ester functional group suggests that it may be involved in reactions typical of esters, such as hydrolysis or transesterification. Additionally, the bulky 1,1-dimethylethyl group can influence the compound's solubility and reactivity. Overall, this compound may be explored for applications in agriculture, pharmaceuticals, or as a biochemical tool, depending on its specific interactions and properties in biological systems. Further studies would be necessary to fully elucidate its characteristics and potential uses.
Formula:C8H14N4O2
InChI:InChI=1S/C8H14N4O2/c1-8(2,3)14-7(13)9-4-6-5-10-12-11-6/h5H,4H2,1-3H3,(H,9,13)(H,10,11,12)
InChI key:HUMUTQCCJLWSPT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1=NNN=C1
Synonyms:
  • Carbamic acid, N-(1H-1,2,3-triazol-5-ylmethyl)-, 1,1-dimethylethyl ester
  • tert-butyl ((1H-1,2,3-triazol-5-yl)methyl)carbamate
Found 4 products.