CAS 1009349-32-9
:Benzene,1-(bromomethyl)-2,5-dichloro-3-nitro-
Description:
Benzene, 1-(bromomethyl)-2,5-dichloro-3-nitro- is an organic compound characterized by its aromatic benzene ring substituted with various functional groups. The presence of a bromomethyl group indicates a bromine atom attached to a methyl group, which is further linked to the benzene ring. The compound also features two chlorine atoms at the 2 and 5 positions of the benzene ring, contributing to its chlorinated nature, while a nitro group is present at the 3 position, imparting additional reactivity and polarity. This combination of substituents suggests that the compound may exhibit significant chemical reactivity, particularly in electrophilic substitution reactions. The presence of halogens and a nitro group can influence the compound's physical properties, such as solubility and boiling point, as well as its potential applications in synthesis and materials science. Safety considerations are important due to the toxicity and environmental impact associated with halogenated compounds and nitro groups. Overall, this compound is of interest in both synthetic organic chemistry and potential industrial applications.
Formula:C7H4BrCl2NO2
InChI:InChI=1S/C7H4BrCl2NO2/c8-3-4-1-5(9)2-6(7(4)10)11(12)13/h1-2H,3H2
InChI key:XPFMDGKKMHNURO-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1CBr)Cl)[N+](=O)[O-])Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
