CymitQuimica logo

CAS 1009376-98-0

:

1-(1,1-Dimethylethyl) 3-methyl (3S,6R)-6-methyl-1,3-piperidinedicarboxylate

Description:
1-(1,1-Dimethylethyl) 3-methyl (3S,6R)-6-methyl-1,3-piperidinedicarboxylate, with the CAS number 1009376-98-0, is a chemical compound characterized by its piperidine structure, which includes two carboxylate functional groups. This compound features a tert-butyl group (1,1-dimethylethyl) and a methyl group at specific positions on the piperidine ring, contributing to its steric and electronic properties. The stereochemistry indicated by (3S,6R) suggests specific spatial arrangements of atoms, which can influence the compound's reactivity and interactions with biological systems. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents, potential biological activity, and specific melting and boiling points, although these properties can vary based on purity and environmental conditions. The presence of multiple functional groups often allows for diverse chemical reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Further characterization would typically involve techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.
Formula:C13H23NO4
InChI:InChI=1S/C13H23NO4/c1-9-6-7-10(11(15)17-5)8-14(9)12(16)18-13(2,3)4/h9-10H,6-8H2,1-5H3/t9-,10+/m1/s1
InChI key:InChIKey=HDRXORRYMWSTTC-ZJUUUORDSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](C(OC)=O)CC[C@H]1C
Synonyms:
  • 1-(1,1-Dimethylethyl) 3-methyl (3S,6R)-6-methyl-1,3-piperidinedicarboxylate
  • 1,3-Piperidinedicarboxylic acid, 6-methyl-, 1-(1,1-dimethylethyl) 3-methyl ester, (3S,6R)-
Found 3 products.