CAS 100939-96-6
:1-(2-Methoxyphenyl)piperazine hydrobromide
Description:
1-(2-Methoxyphenyl)piperazine hydrobromide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methoxy-substituted phenyl group, enhancing its potential for biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical applications. The presence of the methoxy group may influence its pharmacokinetic properties, such as absorption and distribution. This compound is often studied for its potential effects on the central nervous system, as piperazine derivatives are known to interact with various neurotransmitter receptors. Its molecular structure suggests possible applications in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C10H15BrN2
InChI:InChI=1/C10H14N2.BrH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;/h1-5,11H,6-9H2;1H
SMILES:c1ccc(cc1)N1CCNCC1.Br
Synonyms:- 1-(2-Methoxylphenyl)-Piperazine HBr
- 1-Phenylpiperazine Hydrobromide
- 1-(2-Methoxyphenyl) Piperazine HBr
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(2-Methoxyphenyl)piperazine Hydrobromide
CAS:Controlled ProductStability Hygroscopic
Applications 1-(2-Methoxyphenyl)piperazine Hydrobromide is a useful reagent for improving the synthesis of Eapidil.
References Wang, H., et al.: Anhui Huagong, 37, 23 (2011)Formula:C11H16N2O·HBrColor and Shape:NeatMolecular weight:273.171-(2-Methoxylphenyl)-piperazine monohydrobromide
CAS:Controlled ProductPlease enquire for more information about 1-(2-Methoxylphenyl)-piperazine monohydrobromide including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%


