CAS 10095-06-4
:Tetrahydro-1,3,4,6-tetramethylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
Description:
Tetrahydro-1,3,4,6-tetramethylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione, commonly known as a derivative of imidazole, is a heterocyclic organic compound characterized by its complex ring structure that includes nitrogen atoms. This compound features a fused imidazole ring system, which contributes to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar nature due to the presence of nitrogen and carbonyl functional groups. The compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential biological activities. Its structure allows for various interactions with biological macromolecules, making it a candidate for further research in medicinal chemistry. Additionally, the presence of multiple methyl groups enhances its lipophilicity, which can influence its bioavailability and pharmacokinetics. Safety data indicates that, like many nitrogen-containing heterocycles, it should be handled with care, as it may exhibit toxicity or other health effects under certain conditions.
Formula:C8H14N4O2
InChI:InChI=1S/C8H14N4O2/c1-9-5-6(11(3)7(9)13)12(4)8(14)10(5)2/h5-6H,1-4H3
InChI key:InChIKey=XIUUSFJTJXFNGH-UHFFFAOYSA-N
SMILES:CN1C2C(N(C)C(=O)N2C)N(C)C1=O
Synonyms:- 1,3,4,6-Tetramethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione
- 1,3,4,6-Tetramethyl-tetrahydro-imidazo[4,5-d]imidazole-2,5-dione
- 1,3,4,6-tetramethyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
- 2,4,6,8-Tetramethyl-2,4,6,8-tetraazabicyclo[3.3.0]-3,7-oxandione
- Glycoluril, 1,3,4,6-tetramethyl-
- Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetramethyl-
- Mebicar
- Tetrahydro-1,3,4,6-tetramethylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
- Mebikar
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetramethyl-
CAS:Formula:C8H14N4O2Purity:98%Color and Shape:SolidMolecular weight:198.2224Temgicoluril
CAS:Temgicoluril (mebikar) acts on GABA Receptor.Formula:C8H14N4O2Purity:99.8%Color and Shape:SolidMolecular weight:198.22Tetrahydro-1,3,4,6-tetramethylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
CAS:Tetrahydro-1,3,4,6-tetramethylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione (DMTI) is a phosphotungstic acid analog that has been shown to have potent synergic activity with pharmacological agents used in the treatment of congestive heart failure. It increases ATP production in cells by inhibiting the enzyme pyruvate dehydrogenase kinase and stimulating protein kinase C. DMTI also has an effect on energy metabolism by increasing the concentration of adenosine monophosphate (AMP) and decreasing the concentration of adenosine triphosphate (ATP). DMTI is a chiral compound that contains two asymmetric carbon atoms. The molecule itself is not biologically active but must be metabolized to produce the active form. This compound has a high affinity for oxytocin receptors and can be used to induceFormula:C8H14N4O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:198.22 g/mol1,3,4,6-tetramethyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
CAS:Formula:C8H14N4O2Purity:98%Color and Shape:SolidMolecular weight:198.226Tetrahydro-1,3,4,6-tetramethylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
CAS:Controlled ProductFormula:C8H14N4O2Color and Shape:NeatMolecular weight:198.22







