CymitQuimica logo

CAS 100958-94-9

:

2-METHYL-3,5-DIBROMOBENZOIC ACID

Description:
2-Methyl-3,5-dibromobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure with two bromine substituents and a methyl group. The molecular formula typically includes carbon, hydrogen, and bromine atoms, reflecting its halogenated nature. This compound is known for its moderate solubility in organic solvents and limited solubility in water, which is common for halogenated aromatic compounds. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidic properties, allowing it to participate in acid-base reactions. Additionally, the specific arrangement of substituents on the benzene ring influences its physical and chemical properties, such as melting point and boiling point, as well as its potential biological activity. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C8H6Br2O2
InChI:InChI=1S/C8H6Br2O2/c1-4-6(8(11)12)2-5(9)3-7(4)10/h2-3H,1H3,(H,11,12)
InChI key:ZEZXVIRBOFKOMW-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1Br)Br)C(=O)O
Found 6 products.