CymitQuimica logo

CAS 100960-68-7

:

Benzonitrile, 4-chloro-2-methoxy-

Description:
4-Chloro-2-methoxybenzonitrile, with the CAS number 100960-68-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group, a methoxy group, and a nitrile group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate polarity due to the presence of the nitrile and methoxy groups, which can influence its solubility in various organic solvents. The chloro substituent can enhance the compound's reactivity, making it useful in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 4-chloro-2-methoxybenzonitrile may exhibit biological activity, which can be explored in medicinal chemistry. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and environmental hazards. Proper storage and handling protocols are essential to mitigate risks associated with exposure.
Formula:C8H6ClNO
InChI:InChI=1S/C8H6ClNO/c1-11-8-4-7(9)3-2-6(8)5-10/h2-4H,1H3
InChI key:RMEKKIFVJZOQEG-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)Cl)C#N
Found 3 products.