CymitQuimica logo

CAS 100980-82-3

:

4-(4-Hydroxyphenyl)benzaldehyde

Description:
4-(4-Hydroxyphenyl)benzaldehyde, also known as p-hydroxyphenylbenzaldehyde, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a biphenyl structure. This compound features a phenolic hydroxyl group on one phenyl ring and an aldehyde functional group on the adjacent phenyl ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The compound is known for its potential use in the synthesis of various pharmaceuticals, dyes, and agrochemicals due to its ability to undergo electrophilic aromatic substitution reactions. Additionally, its hydroxyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. Safety data indicates that it should be handled with care, as it may pose risks upon exposure.
Formula:C13H10O2
InChI:InChI=1S/C13H10O2/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-9,15H
InChI key:LUWJPGMZEAYDBA-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C=O)C2=CC=C(C=C2)O
Found 4 products.