CAS 100992-59-4
:epiamastatin hydrochloride
Description:
Epiamastatin hydrochloride is a synthetic compound that belongs to the class of peptidomimetics, which are designed to mimic the structure and function of peptides. It is primarily recognized for its role as a potent inhibitor of certain enzymes, particularly those involved in the regulation of biological processes such as cell proliferation and differentiation. The compound exhibits a high degree of specificity and affinity for its target enzymes, making it a valuable tool in biochemical research and potential therapeutic applications. Epiamastatin hydrochloride is typically characterized by its solubility in water and organic solvents, which facilitates its use in various experimental settings. Additionally, it possesses a unique molecular structure that contributes to its biological activity. Safety and handling precautions are essential when working with this compound, as with many chemical substances, to mitigate any potential health risks. Overall, epiamastatin hydrochloride represents an important compound in the study of enzyme inhibition and its implications in pharmacology and medicinal chemistry.
Formula:C21H39ClN4O8
InChI:InChI=1/C21H38N4O8.ClH/c1-9(2)7-12(22)17(28)20(31)25-16(11(5)6)19(30)24-15(10(3)4)18(29)23-13(21(32)33)8-14(26)27;/h9-13,15-17,28H,7-8,22H2,1-6H3,(H,23,29)(H,24,30)(H,25,31)(H,26,27)(H,32,33);1H
SMILES:CC(C)CC(C(C(=NC(C(C)C)C(=NC(C(C)C)C(=NC(CC(=O)O)C(=O)O)O)O)O)O)N.Cl
Synonyms:- Epiamastatin . HCl
- [(2R,3R)-3-Amino-2-hydroxy-5-methylhexanoyl]-Val-Val-Asp-OH . HCl
- N-(3-amino-2-hydroxy-5-methylhexanoyl)valylvalylaspartic acid hydrochloride
- EPIAMASTATIN
- [(2R,3R)-3-AMINO-2-HYDROXY-5-METHYLHEXANOYL]-VAL-VAL-ASP HYDROCHLORIDE
- (2R,3R)-AHMHA-Val-Val-Asp-OH HCl
- EPIAMASTATIN HYDROCHLORIDE
- H-(2R,3R)-AHMH-VAL-VAL-ASP-OH HCL
- Epiamastatin hydrochloride >=97% (HPLC)
- (2R,3R)-AHMHA-Val-Val-Asp-OH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Epiamastatin hydrochloride
CAS:Epiamastatin hydrochlorideFormula:C21H38N4O8·ClHColor and Shape:SolidMolecular weight:511.00935



