CAS 101001-34-7
:2-[4,5-Bis(4-methoxyphenyl)thiazol-2-yl]pyrrole-1-acetic acid ethyl ester
Description:
2-[4,5-Bis(4-methoxyphenyl)thiazol-2-yl]pyrrole-1-acetic acid ethyl ester is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring, a thiazole moiety, and an ethyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of methoxyphenyl groups may contribute to its lipophilicity and influence its interaction with biological targets. Additionally, the thiazole and pyrrole components can impart unique electronic properties, which may enhance its reactivity and stability. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound represents a class of heterocyclic compounds that are often explored for their diverse biological activities.
Formula:C25H24N2O4S
InChI:InChI=1/C25H24N2O4S/c1-4-31-22(28)16-27-15-5-6-21(27)25-26-23(17-7-11-19(29-2)12-8-17)24(32-25)18-9-13-20(30-3)14-10-18/h5-15H,4,16H2,1-3H3
InChI key:InChIKey=ISCHOARKJADAKJ-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(C2=C(SC(=N2)C=3N(CC(OCC)=O)C=CC3)C4=CC=C(OC)C=C4)C=C1
Synonyms:- 1H-Pyrrole-1-acetic acid, 2-[4,5-bis(4-methoxyphenyl)-2-thiazolyl]-, ethyl ester
- Ethyl 2-[4,5-bis(p-methoxyphenyl)-2-thiazolyl]pyrrole-1-acetate
- Kb-3022
- Kbt-3022
- Pamicogrel
- Paminate
- To-192
- ethyl {2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetate
- ethyl 2-(2-(4,5-bis(4-methoxyphenyl)thiazol-2-yl)-1H-pyrrol-1-yl)acetate
- ethyl 2-[4,5-bis(4-methoxyphenyl)thiazol-2-yl]-pyrrole-1-acetate
- 2-[4,5-Bis(4-methoxyphenyl)thiazol-2-yl]-1H-pyrrole-1-acetic acid ethyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pamicogrel
CAS:Ethyl 2-(2-(4,5-bis(4-methoxyphenyl)thiazol-2-yl)-1H-pyrrol-1-yl)acetateFormula:C25H24N2O4SPurity:99%Molecular weight:448.53Pamicogrel
CAS:Pamicogrel (KBT3022) is an inhibitor of COX.Formula:C25H24N2O4SPurity:99.83%Color and Shape:SolidMolecular weight:448.53Ethyl 2-(2-(4,5-Bis(4-Methoxyphenyl)Thiazol-2-Yl)-1H-Pyrrol-1-Yl)Acetate
CAS:Ethyl 2-(2-(4,5-Bis(4-Methoxyphenyl)Thiazol-2-Yl)-1H-Pyrrol-1-Yl)AcetateFormula:C25H24N2O4SPurity:99%Molecular weight:448.53Ethyl 2-(2-(4,5-bis(4-methoxyphenyl)thiazol-2-yl)-1H-pyrrol-1-yl)acetate
CAS:Ethyl 2-(2-(4,5-bis(4-methoxyphenyl)thiazol-2-yl)-1H-pyrrol-1-yl)acetate (ETP) is a drug that has been shown to inhibit cancer stem cells. It is an antiplatelet drug and has been shown to have the ability to repair muscle tissue by stimulating the production of fatty acids such as butyric acid. ETP also inhibits insulin resistance, which may be beneficial in treating metabolic disorders. ETP is metabolized into indirubin, which has been shown to have pharmacological effects on cancer cells.Formula:C25H24N2O4SPurity:Min. 95%Molecular weight:448.5 g/mol




