CAS 101003-65-0
:4'-HYDROXY-2,2':6',2'-TERPYRIDINE
Description:
4'-Hydroxy-2,2':6',2'-terpyridine, with the CAS number 101003-65-0, is a chemical compound characterized by its unique structure, which consists of a terpyridine framework with a hydroxyl group at the 4' position. This compound exhibits properties typical of pyridine derivatives, including potential coordination abilities with metal ions due to the presence of nitrogen atoms in the aromatic rings. The hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with other chemical species. 4'-Hydroxy-2,2':6',2'-terpyridine can serve as a ligand in coordination chemistry, potentially forming complexes with transition metals, which can be useful in catalysis and materials science. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary depending on the specific conditions, such as pH and the presence of other reagents. Overall, this compound represents a versatile building block in both organic synthesis and coordination chemistry.
Formula:C15H11N3O
InChI:InChI=1/C15H11N3O/c19-11-9-14(12-5-1-3-7-16-12)18-15(10-11)13-6-2-4-8-17-13/h1-10H,(H,18,19)
SMILES:c1ccnc(c1)c1cc(cc(c2ccccn2)n1)O
Synonyms:- [2,2':6',2''-terpyridin]-4'(1'H)-one
- [2,2':6',2''-Terpyridin]-4'-Ol
- 101003-65-0
- 4'-Hydroxy-2,2':6',2''-terpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[2,2:6,2-Terpyridin]-4--Ol
CAS:[2,2:6,2-Terpyridin]-4--OlFormula:C15H11N3OPurity:99%Molecular weight:249.27[2,2':6',2''-Terpyridin]-4'-ol
CAS:Formula:C15H11N3OPurity:98%Color and Shape:SolidMolecular weight:249.26734'-Hydroxy-2,2':6',2''-terpyridine
CAS:4'-Hydroxy-2,2':6',2''-terpyridine is a molecule with the molecular formula C24H22N4O8. It is an organic compound that belongs to the group of heterocycles. It has been found to be a ligand for metal ions and has been shown to interact with particles at temperatures below 20°C. 4'-Hydroxy-2,2':6',2''-terpyridine crystallizes in two polymorphs: tetragonally (alpha) at room temperature and trigonally (beta) at temperatures below 20°C. The alpha form has been observed to undergo a photophysical reaction as it absorbs light and emits light in the ultraviolet region of the spectrum.
Formula:C15H11N3OPurity:Min. 95%Color and Shape:PowderMolecular weight:249.27 g/mol




