CymitQuimica logo

CAS 101004-95-9

:

(1-OXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)(PHENYL)ACETIC ACID

Description:
(1-OXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)(PHENYL)ACETIC ACID, with the CAS number 101004-95-9, is a chemical compound that features a complex structure combining an isoindole moiety with a phenylacetic acid group. This compound typically exhibits characteristics associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. It may possess moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large aromatic systems. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts. Additionally, the compound's isoindole structure may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Its specific applications and properties would depend on further studies, including its synthesis, stability, and potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C16H13NO3
InChI:InChI=1/C16H13NO3/c18-15-13-9-5-4-8-12(13)10-17(15)14(16(19)20)11-6-2-1-3-7-11/h1-9,14H,10H2,(H,19,20)
InChI key:PNOHRUSRGMQJPS-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(C(=O)O)N1Cc2ccccc2C1=O
Synonyms:
  • 2-(1-Oxo-1,3-Dihydro-2H-Isoindol-2-Yl)-2-Phenylacetic Acid
  • 1,3-Dihydro-1-Oxo-Alpha-Phenyl-2H-Isoindole-2-Acetic Acid
Found 2 products.