CymitQuimica logo

CAS 1010100-07-8

:

CC-885

Description:
CC-885, with the CAS number 1010100-07-8, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is primarily recognized as a selective inhibitor of the protein degradation pathway, specifically targeting the cereblon (CRBN) E3 ubiquitin ligase complex. This compound has shown promise in preclinical studies for its ability to modulate protein homeostasis and induce the degradation of specific oncoproteins, making it a candidate for cancer treatment. CC-885's mechanism of action involves disrupting the interaction between CRBN and its substrates, leading to the targeted degradation of proteins that contribute to tumorigenesis. Additionally, its chemical structure includes features that enhance its bioavailability and selectivity, which are critical for minimizing off-target effects. Ongoing research aims to further elucidate its pharmacokinetic properties, efficacy, and safety profile in various cancer models, paving the way for potential clinical applications.
Formula:C22H21ClN4O4
InChI:InChI=1S/C22H21ClN4O4/c1-12-2-4-15(9-17(12)23)25-22(31)24-10-13-3-5-16-14(8-13)11-27(21(16)30)18-6-7-19(28)26-20(18)29/h2-5,8-9,18H,6-7,10-11H2,1H3,(H2,24,25,31)(H,26,28,29)
InChI key:DOEVCIHTTTYVCC-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)NC(=O)NCC2=CC3=C(C=C2)C(=O)N(C3)C4CCC(=O)NC4=O)Cl
Synonyms:
  • Urea, N-(3-chloro-4-methylphenyl)-N'-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1-oxo-1H-isoindol-5-yl]methyl]-
  • 1-(3-Chloro-4-methylphenyl)-3-((2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-5-yl)methyl)urea
Found 6 products.