CymitQuimica logo

CAS 1010120-55-4

:

5-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine

Description:
5-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine is a heterocyclic organic compound characterized by the presence of a triazole ring fused to a pyridine structure, along with a bromine substituent and an amino group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The bromine atom introduces a halogen functionality, which can influence the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The triazole moiety is known for its biological activity, often serving as a scaffold in drug design. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the triazole and pyridine rings. Its unique structure allows for potential interactions with biological targets, making it a subject of interest in research related to drug discovery and development. Overall, 5-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine is a versatile compound with significant implications in various chemical and biological fields.
Formula:C6H5BrN4
InChI:InChI=1S/C6H5BrN4/c7-4-2-1-3-5-9-6(8)10-11(4)5/h1-3H,(H2,8,10)
InChI key:TVGFHUIJNZRKFW-UHFFFAOYSA-N
SMILES:C1=CC2=NC(=NN2C(=C1)Br)N
Synonyms:
  • 5-Bromo-[1,2,4]Triazolo[1,5-A]Pyridin-2-Amine
  • 2-Amino-5-bromo-[1,2,4]triazolo[1,5-a]pyridin
Found 5 products.