CymitQuimica logo

CAS 101079-67-8

:

3-Chloro-2,6-dinitropyridine

Description:
3-Chloro-2,6-dinitropyridine is a chemical compound with the molecular formula C5H3ClN4O4. It features a pyridine ring substituted with two nitro groups at the 2 and 6 positions and a chlorine atom at the 3 position. This compound is typically characterized by its yellow crystalline appearance and is known for its potential applications in the synthesis of various organic compounds, particularly in the field of agrochemicals and pharmaceuticals. The presence of nitro groups contributes to its reactivity, making it a useful intermediate in chemical reactions. Additionally, 3-chloro-2,6-dinitropyridine exhibits properties such as being a potential explosive due to the nitro groups, which can undergo reduction or substitution reactions. Safety precautions are essential when handling this compound, as it may pose health risks through inhalation or skin contact. Its stability and reactivity can vary depending on environmental conditions, making it important to store it properly to prevent degradation or unintended reactions.
Formula:C5H2ClN3O4
InChI:InChI=1/C5H2ClN3O4/c6-3-1-2-4(8(10)11)7-5(3)9(12)13/h1-2H
InChI key:InChIKey=ZXEQNAJFLDCBQY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1N=C(N(=O)=O)C=CC1Cl
Synonyms:
  • 3-Chloro-2,6-dinitropyridine
  • Pyridine, 3-Chloro-2,6-Dinitro-
Found 2 products.