CymitQuimica logo

CAS 101084-60-0

:

2(3H)-Benzoxazolone, 3-methyl-5-nitro-

Description:
2(3H)-Benzoxazolone, 3-methyl-5-nitro- is an organic compound characterized by its benzoxazolone structure, which features a fused benzene and oxazolone ring. The presence of a methyl group at the 3-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various applications, including as a dye or pigment. Its nitro group can participate in electrophilic substitution reactions, while the oxazolone moiety can engage in nucleophilic attacks, indicating potential reactivity. The compound may also display biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted, as nitro compounds can sometimes pose health risks. Overall, 2(3H)-Benzoxazolone, 3-methyl-5-nitro- is a versatile compound with applications in organic synthesis and materials science.
Formula:C8H6N2O4
InChI:InChI=1S/C8H6N2O4/c1-9-6-4-5(10(12)13)2-3-7(6)14-8(9)11/h2-4H,1H3
InChI key:NEUIGIUWAYOYAM-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC(=C2)[N+](=O)[O-])OC1=O
Found 2 products.