CAS 101094-05-7
:Modafinil Carboxylate Sulfone
Description:
Modafinil Carboxylate Sulfone, with the CAS number 101094-05-7, is a chemical compound derived from modafinil, a wakefulness-promoting agent commonly used to treat sleep disorders such as narcolepsy and obstructive sleep apnea. This compound is characterized by its sulfone functional group, which contributes to its chemical stability and solubility properties. Modafinil Carboxylate Sulfone is typically a white to off-white solid, and it exhibits moderate polarity, making it soluble in various organic solvents. The compound is known for its pharmacological activity, which includes enhancing cognitive function and alertness. Its mechanism of action is believed to involve the modulation of neurotransmitters in the brain, particularly dopamine and norepinephrine. Additionally, it has a relatively low toxicity profile, making it a subject of interest in both clinical and research settings. As with many pharmaceuticals, the safety and efficacy of Modafinil Carboxylate Sulfone are subject to ongoing investigation, particularly regarding its long-term effects and potential applications beyond sleep disorders.
Formula:C15H14O4S
InChI:InChI=1S/C15H14O4S/c16-14(17)11-20(18,19)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,16,17)
InChI key:XTXZDQKYJIHOMB-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(C2=CC=CC=C2)S(=O)(=O)CC(=O)O
Synonyms:- 2-[(Diphenylmethyl)sulfonyl]acetic Acid
- Nsc 114215
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Modafinil Acid Sulfone
CAS:Formula:C15H14O4SColor and Shape:White To Off-White SolidMolecular weight:290.34Modafinil-d5 Acid Sulfone
CAS:Formula:C15H9O4SD5Color and Shape:White To Off-White SolidMolecular weight:295.37



