CAS 1011-47-8
:2-Acetylquinoline
Description:
2-Acetylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. It is typically a yellow to brown solid at room temperature and has a distinctive aromatic odor. The compound features an acetyl group attached to the second position of the quinoline ring, contributing to its reactivity and potential applications in various chemical reactions. 2-Acetylquinoline is known for its role in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water. The compound can participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the acetyl group, making it a valuable intermediate in synthetic chemistry. Additionally, 2-acetylquinoline has been studied for its biological activities, including potential antimicrobial and anticancer properties, highlighting its significance in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.
Formula:C11H9NO
InChI:InChI=1S/C11H9NO/c1-8(13)10-7-6-9-4-2-3-5-11(9)12-10/h2-7H,1H3
InChI key:InChIKey=UCCQXCFFHYCLEC-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=NC2=C(C=C1)C=CC=C2
Synonyms:- 1-(2-Quinolinyl)ethanone
- 1-(Chinolin-2-yl)ethanon
- 1-(Quinolin-2-yl)ethan-1-one
- 1-(Quinolin-2-yl)ethanone
- 2-Acetylquinoline
- Ethanone, 1-(2-Quinolinyl)-
- Ketone, methyl 2-quinolyl
- Methyl 2-quinolyl ketone
- NSC 256937
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(Quinolin-2-yl)ethanone
CAS:1-(Quinolin-2-yl)ethanoneFormula:C11H9NOPurity:95%Molecular weight:171.2Ethanone, 1-(2-quinolinyl)-
CAS:Formula:C11H9NOPurity:98%Color and Shape:SolidMolecular weight:171.19531-(Quinolin-2-yl)ethanone
CAS:1-(Quinolin-2-yl)ethanoneFormula:C11H9NOPurity:95%Color and Shape:Solid-PowderMolecular weight:171.195261-(Quinolin-2-yl)ethanone
CAS:Controlled ProductFormula:C11H9NOColor and Shape:NeatMolecular weight:171.1951-(Quinolin-2-yl)ethanone
CAS:1-(Quinolin-2-yl)ethanone is an inhibitor of proteolytic enzymes. It is a triazolopyrimidine that binds to the active site of proteases, thereby inhibiting their activity. 1-(Quinolin-2-yl)ethanone has been shown to be effective against viruses such as herpes simplex virus and Streptococcus faecalis, and bacterial infections such as streptococcus faecalis and Staphylococcus aureus. 1-(Quinolin-2-yl)ethanone also inhibits the production of matrix metalloproteinases, which play an important role in tumor development, by binding to the zinc ion in the enzyme's active site. This compound can also be used synergistically with copper chloride or hydrochloric acid to inhibit protease activity.
Formula:C11H9NOPurity:Min. 95%Molecular weight:171.2 g/mol





