CAS 1011-51-4

5-(4-METHOXYPHENYL)OXAZOLE

Description:

5-(4-Methoxyphenyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 4-methoxyphenyl group enhances its aromatic properties and contributes to its overall stability and reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the aromatic moiety. It may display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The methoxy group can influence the electronic properties of the molecule, potentially affecting its interactions with biological targets. Additionally, 5-(4-methoxyphenyl)oxazole can undergo various chemical reactions, including electrophilic substitutions and nucleophilic attacks, which are common for compounds with aromatic systems. Its structural features and reactivity profile make it a valuable compound for research in organic synthesis and pharmacology. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-12-9-4-2-3-8(5-9)10-6-11-7-13-10/h2-7H,1H3

InChI key: WWTDBJIWQKDBSY-UHFFFAOYSA-N

SMILES: COc1cccc(c1)c1cnco1

Synonyms:

• 5-(4-Methoxyphenyl)-1,3-Oxazole
• 5-(3-Methoxy-phenyl)-oxazole

5-(4-Methoxyphenyl)oxazole

CAS: 1011-51-4

5-(4-Methoxyphenyl)oxazole

Formula: C₁₀H₉NO₂

Purity: 95%

Molecular weight: 175.187

Ref: 10-F518258

Oxazole, 5-(4-methoxyphenyl)-

CAS: 1011-51-4

Formula: C₁₀H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA0003RL

MPO

CAS: 1011-51-4

MPO

Formula: C₁₀H₉NO₂

Purity: 99.5%

Molecular weight: 175.18

Ref: 54-BUP12106

MPO

CAS: 1011-51-4

MPO (5-(4'-Methoxyphenyl)-oxazole) is a hatch and growth of Caenorhabditis Elegans inhibitor.

Formula: C₁₀H₉NO₂

Purity: 99.86%

Color and Shape: Solid

Molecular weight: 175.184

Ref: TM-T19972