CymitQuimica logo

CAS 1011018-52-2

:

4-((4-iodophenoxy)methyl)benzamide

Description:
4-((4-Iodophenoxy)methyl)benzamide is an organic compound characterized by its structural features, which include a benzamide moiety and a 4-iodophenoxy group. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the iodine atom in the 4-iodophenyl group can impart unique electronic properties, potentially influencing its reactivity and interactions in biological systems. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block for more complex molecules. Additionally, the presence of the amide functional group suggests that it may participate in hydrogen bonding, which can affect its physical properties and biological activity. As with many organic compounds, safety precautions should be taken when handling it, and its stability should be assessed under various conditions.
Formula:C14H12INO2
InChI:InChI=1S/C14H12INO2/c15-12-5-7-13(8-6-12)18-9-10-1-3-11(4-2-10)14(16)17/h1-8H,9H2,(H2,16,17)
InChI key:JXBDPGSFYYLEIX-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1COC2=CC=C(C=C2)I)C(=O)N
Synonyms:
  • Benzamide, 4-[(4-iodophenoxy)methyl]-
  • 4-((4-iodophenoxy)methyl)benzamide
Found 3 products.