CymitQuimica logo

CAS 1011366-31-6

:

Pyrazolo[1,5-a]pyrimidine-7-carboxylic acid, 5-(1,3-benzodioxol-5-yl)-2-phenyl-, methyl ester

Description:
Pyrazolo[1,5-a]pyrimidine-7-carboxylic acid, 5-(1,3-benzodioxol-5-yl)-2-phenyl-, methyl ester, identified by CAS number 1011366-31-6, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a pyrazolo-pyrimidine core, which is known for its potential biological activity, particularly in medicinal chemistry. The presence of the benzodioxole moiety contributes to its aromatic character and may enhance its interaction with biological targets. As a methyl ester, it exhibits increased lipophilicity, which can influence its absorption and distribution in biological systems. The compound may possess various functional groups that can participate in chemical reactions, making it a candidate for further modifications in drug development. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific enzymes or receptors. However, detailed studies on its pharmacological properties, toxicity, and mechanism of action would be necessary to fully understand its potential applications in medicinal chemistry.
Formula:C21H15N3O4
InChI:InChI=1S/C21H15N3O4/c1-26-21(25)17-10-15(14-7-8-18-19(9-14)28-12-27-18)22-20-11-16(23-24(17)20)13-5-3-2-4-6-13/h2-11H,12H2,1H3
InChI key:DCSWTUKGGUNNLU-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=NC2=CC(=NN12)C3=CC=CC=C3)C4=CC5=C(C=C4)OCO5
Synonyms:
  • MCI-INI-3
  • Pyrazolo[1,5-a]pyrimidine-7-carboxylic acid, 5-(1,3-benzodioxol-5-yl)-2-phenyl-, methyl ester
Found 3 products.