CAS 10114-40-6
:1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid
Description:
1,3,4,5,7,8-Hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid, commonly referred to as a sulfonated derivative of anthraquinone, is a complex organic compound characterized by its multiple hydroxyl and sulfonic acid functional groups. This structure contributes to its high solubility in water and potential applications in various fields, including dye chemistry and as a pH indicator. The presence of dioxo groups indicates strong oxidative properties, which can be utilized in redox reactions. The compound's sulfonic acid groups enhance its ionic character, making it useful in applications requiring high stability and reactivity in aqueous environments. Additionally, the hexahydroxy substitution pattern suggests potential for extensive hydrogen bonding, influencing its physical properties such as melting point and solubility. Overall, this compound's unique structural features make it significant in both industrial and research contexts, particularly in the development of dyes and pigments.
Formula:C14H8O14S2
InChI:InChI=1/C14H8O14S2/c15-5-1-3(9(19)13(29(23,24)25)11(21)7(1)17)6(16)2-4(5)10(20)14(30(26,27)28)12(22)8(2)18/h17-22H,(H,23,24,25)(H,26,27,28)
SMILES:c12c(C(=O)c3c(C1=O)c(c(c(c3O)O)S(=O)(=O)O)O)c(c(c(c2O)O)S(=O)(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acid Alizarin Blue BB
CAS:Controlled ProductApplications Acid Alizarin Blue BB is a dye as hematoxylin substitute.
References Lillie, R., et al.: Stain Technol., 51, 25 (1976)Formula:C14H6Na2O14S2Color and Shape:NeatMolecular weight:508.3
