CymitQuimica logo

CAS 1011711-57-1

:

4-Ethoxy-1H-pyrrolo[2,3-b]pyridine

Description:
4-Ethoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole ring fused together. This compound features an ethoxy group (-OCH2CH3) at the 4-position of the pyrrole ring, contributing to its chemical reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. The presence of both nitrogen atoms in the rings can influence its basicity and potential interactions with other chemical species. 4-Ethoxy-1H-pyrrolo[2,3-b]pyridine may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various diseases. Its synthesis and characterization often involve standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many organic compounds, safety precautions should be taken when handling this substance in a laboratory setting.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-2-12-8-4-6-11-9-7(8)3-5-10-9/h3-6H,2H2,1H3,(H,10,11)
InChI key:KRYAWEHDTJSEAG-UHFFFAOYSA-N
SMILES:CCOC1=C2C=CNC2=NC=C1
Synonyms:
  • 4-Ethoxy-7-azaindole
  • 4-Ethoxy-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4-ethoxy-
Found 4 products.