CymitQuimica logo

CAS 1011722-07-8

:

(6-Cyanopyridin-3-yl)boronicacid

Description:
(6-Cyanopyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that also contains a cyano group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The presence of the cyano group enhances its reactivity, making it useful in various chemical reactions, including Suzuki coupling, which is a method for forming carbon-carbon bonds. Additionally, the boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it valuable in medicinal chemistry and materials science. Its unique structural features contribute to its potential applications in drug development, particularly in the synthesis of biologically active compounds. As with many boronic acids, it is important to handle this substance with care, as it may have specific safety and environmental considerations.
Formula:C6H5BN2O2
InChI:InChI=1S/C6H5BN2O2/c8-3-6-2-1-5(4-9-6)7(10)11/h1-2,4,10-11H
InChI key:JRWBBVDYZMMZOH-UHFFFAOYSA-N
SMILES:c1cc(C#N)ncc1B(O)O
Synonyms:
  • (6-Cyanopyridin-3-yl)boronic acid
  • 2-Cyanopyridine-5-boronic acid
Found 4 products.