CAS 1011758-03-4
:11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine
Description:
11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine is a chemical compound characterized by its complex structure, which includes a dibenzo[b,f][1,4]thiazepine core fused with a piperazine ring substituted with an ethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential pharmacological activity due to its ability to interact with biological targets. The presence of the thiazepine ring suggests it may possess unique electronic and steric properties, influencing its reactivity and solubility. Additionally, the piperazine moiety is known for its role in enhancing the compound's bioavailability and pharmacokinetic profile. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of psychiatry and neurology, due to their ability to modulate neurotransmitter systems. However, specific characteristics such as melting point, solubility, and stability would require empirical data for precise determination. Overall, this compound represents a class of molecules with significant interest in medicinal chemistry and drug development.
Formula:C19H21N3S
InChI:InChI=1S/C19H21N3S/c1-2-21-11-13-22(14-12-21)19-15-7-3-5-9-17(15)23-18-10-6-4-8-16(18)20-19/h3-10H,2,11-14H2,1H3
InChI key:InChIKey=KUKQJNQKJWEVCE-UHFFFAOYSA-N
SMILES:C(C)N1CCN(C=2C=3C(SC=4C(N2)=CC=CC4)=CC=CC3)CC1
Synonyms:- 11-(4-Ethyl-1-piperazinyl)dibenzo[b,f][1,4]thiazepine
- 11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine
- Dibenzo[b,f][1,4]thiazepine, 11-(4-ethyl-1-piperazinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Quetiapine EP Impurity P Fumarate
CAS:Formula:C19H21N3S·C4H4O4Color and Shape:White To Off-White SolidMolecular weight:323.46 116.0711-(4-Ethyl-1-piperazinyl)-dibenzo[b,f][1,4]thiazepine Dihydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications 11-(4-Ethyl-1-piperazinyl)-dibenzo[b,f][1,4]thiazepine is an impurity of Quetiapine hemifumarate (Q510000), a dibenzothiazepine antipsychotic medication used in the treatment of schizophrenia.
References Kumar, K., et al.: Org. Chem.: An Indian Journal, 8, 164 (2012); Raju, I., et al.: Chromatographia, 70, 545 (2009)Formula:C19H23Cl2N3SColor and Shape:NeatMolecular weight:396.3811-(4-Ethyl-1-piperazinyl)-dibenzo[b,f][1,4]thiazepine-D5 Dihydrochloride
CAS:Controlled ProductApplications 11-(4-Ethyl-1-piperazinyl)-dibenzo[b,f][1,4]thiazepine-D5 is a labelled analogue of 11-(4-Ethyl-1-piperazinyl)-dibenzo[b,f][1,4]thiazepine (E925790).
Formula:C19D5H16N3SColor and Shape:NeatMolecular weight:328.486Quetiapine ep impurity P
CAS:Quetiapine ep impurity P is a metabolite of quetiapine. It is a synthetic compound with pharmacopoeia and analytical standards available. Quetiapine ep impurity P is used in research and development to study the metabolism of quetiapine, but it also has niche uses in drug product development. Quetiapine ep impurity P can be synthesized by high-purity custom synthesis or natural methods, such as from plants.Formula:C19H21N3SPurity:Min. 95%Molecular weight:323.5 g/mol



